C21H12F2N2O3 — CID 42624958
(6,7-difluoro-1-oxido-4-oxo-3-phenylquinoxalin-4-ium-2-yl)-phenylmethanone (PubChem CID 42624958) has the molecular formula C21H12F2N2O3 and a molecular weight of 378.33 g/mol. Its IUPAC name is (6,7-difluoro-1-oxido-4-oxo-3-phenylquinoxalin-4-ium-2-yl)-phenylmethanone.
| Compound Name | (6,7-difluoro-1-oxido-4-oxo-3-phenylquinoxalin-4-ium-2-yl)-phenylmethanone |
|---|---|
| PubChem CID | 42624958 |
| Molecular Formula | C21H12F2N2O3 |
| Molecular Weight | 378.33 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | (6,7-difluoro-1-oxido-4-oxo-3-phenylquinoxalin-4-ium-2-yl)-phenylmethanone |
| SMILES | O=C(c1ccccc1)c1c(-c2ccccc2)[n+](=O)c2cc(F)c(F)cc2n1[O-] |
| InChI | InChI=1S/C21H12F2N2O3/c22-15-11-17-18(12-16(15)23)25(28)20(21(26)14-9-5-2-6-10-14)19(24(17)27)13-7-3-1-4-8-13/h1-12H |
| InChIKey | UCAVBBRQNNZHHV-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 68.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.33 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|