C29H42N2O9 — CID 42627256
[(4E,8S,9S,10E,12S,13R,14S,16R)-13-hydroxy-8,14,19-trimethoxy-4,10,12,16-tetramethyl-3,20,22-trioxo-2-azabicyclo[16.3.1]docosa-1,4,10,18-tetraen-9-yl] carbamate (PubChem CID 42627256) has the molecular formula C29H42N2O9 and a molecular weight of 562.66 g/mol. Its IUPAC name is [(4E,8S,9S,10E,12S,13R,14S,16R)-13-hydroxy-8,14,19-trimethoxy-4,10,12,16-tetramethyl-3,20,22-trioxo-2-azabicyclo[16.3.1]docosa-1,4,10,18-tetraen-9-yl] carbamate.
| Compound Name | [(4E,8S,9S,10E,12S,13R,14S,16R)-13-hydroxy-8,14,19-trimethoxy-4,10,12,16-tetramethyl-3,20,22-trioxo-2-azabicyclo[16.3.1]docosa-1,4,10,18-tetraen-9-yl] carbamate |
|---|---|
| PubChem CID | 42627256 |
| Molecular Formula | C29H42N2O9 |
| Molecular Weight | 562.66 g/mol |
| Exact Mass | 562.29 |
| IUPAC Name | [(4E,8S,9S,10E,12S,13R,14S,16R)-13-hydroxy-8,14,19-trimethoxy-4,10,12,16-tetramethyl-3,20,22-trioxo-2-azabicyclo[16.3.1]docosa-1,4,10,18-tetraen-9-yl] carbamate |
| SMILES | COC1=C2C[C@@H](C)C[C@H](OC)[C@H](O)[C@@H](C)/C=C(\C)[C@H](OC(N)=O)[C@@H](OC)CC/C=C(\C)C(=O)/N=C(\CC1=O)C2=O |
| InChI | InChI=1S/C29H42N2O9/c1-15-11-19-25(34)20(14-21(32)27(19)39-7)31-28(35)16(2)9-8-10-22(37-5)26(40-29(30)36)18(4)13-17(3)24(33)23(12-15)38-6/h9,13,15,17,22-24,26,33H,8,10-12,14H2,1-7H3,(H2,30,36)/b16-9+,18-13+,31-20+/t15-,17+,22+,23+,24-,26+/m1/s1 |
| InChIKey | PCMLGGSBMOVPQI-TXZWBFBPSA-N |
| XLogP | 2.99 |
| TPSA | 163.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.66 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|