C29H44N2O8 — CID 24985334
[(4E,8S,9S,10E,12S,13R,14S,16R)-13,22-dihydroxy-8,14,19-trimethoxy-4,10,12,16-tetramethyl-3-oxo-2-azabicyclo[16.3.1]docosa-1(22),4,10,18,20-pentaen-9-yl] carbamate (PubChem CID 24985334) has the molecular formula C29H44N2O8 and a molecular weight of 548.68 g/mol. Its IUPAC name is [(4E,8S,9S,10E,12S,13R,14S,16R)-13,22-dihydroxy-8,14,19-trimethoxy-4,10,12,16-tetramethyl-3-oxo-2-azabicyclo[16.3.1]docosa-1(22),4,10,18,20-pentaen-9-yl] carbamate.
| Compound Name | [(4E,8S,9S,10E,12S,13R,14S,16R)-13,22-dihydroxy-8,14,19-trimethoxy-4,10,12,16-tetramethyl-3-oxo-2-azabicyclo[16.3.1]docosa-1(22),4,10,18,20-pentaen-9-yl] carbamate |
|---|---|
| PubChem CID | 24985334 |
| Molecular Formula | C29H44N2O8 |
| Molecular Weight | 548.68 g/mol |
| Exact Mass | 548.31 |
| IUPAC Name | [(4E,8S,9S,10E,12S,13R,14S,16R)-13,22-dihydroxy-8,14,19-trimethoxy-4,10,12,16-tetramethyl-3-oxo-2-azabicyclo[16.3.1]docosa-1(22),4,10,18,20-pentaen-9-yl] carbamate |
| SMILES | COc1ccc2c(O)c1C[C@@H](C)C[C@H](OC)[C@H](O)[C@@H](C)/C=C(\C)[C@H](OC(N)=O)[C@@H](OC)CC/C=C(\C)C(=O)N2 |
| InChI | InChI=1S/C29H44N2O8/c1-16-13-20-22(36-5)12-11-21(26(20)33)31-28(34)17(2)9-8-10-23(37-6)27(39-29(30)35)19(4)15-18(3)25(32)24(14-16)38-7/h9,11-12,15-16,18,23-25,27,32-33H,8,10,13-14H2,1-7H3,(H2,30,35)(H,31,34)/b17-9+,19-15+/t16-,18+,23+,24+,25-,27+/m1/s1 |
| InChIKey | ZVBIKLIEGCEVNI-AIBLTTSTSA-N |
| XLogP | 4.09 |
| TPSA | 149.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.68 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|