C29H44N2O8 — CID 57326964
[(4E,8S,9S,10E,12S,13R,14S,16R)-13,19-dihydroxy-20-(hydroxymethyl)-8,14-dimethoxy-4,10,12,16-tetramethyl-3-oxo-2-azabicyclo[16.3.1]docosa-1(22),4,10,18,20-pentaen-9-yl] carbamate (PubChem CID 57326964) has the molecular formula C29H44N2O8 and a molecular weight of 548.68 g/mol. Its IUPAC name is [(4E,8S,9S,10E,12S,13R,14S,16R)-13,19-dihydroxy-20-(hydroxymethyl)-8,14-dimethoxy-4,10,12,16-tetramethyl-3-oxo-2-azabicyclo[16.3.1]docosa-1(22),4,10,18,20-pentaen-9-yl] carbamate.
| Compound Name | [(4E,8S,9S,10E,12S,13R,14S,16R)-13,19-dihydroxy-20-(hydroxymethyl)-8,14-dimethoxy-4,10,12,16-tetramethyl-3-oxo-2-azabicyclo[16.3.1]docosa-1(22),4,10,18,20-pentaen-9-yl] carbamate |
|---|---|
| PubChem CID | 57326964 |
| Molecular Formula | C29H44N2O8 |
| Molecular Weight | 548.68 g/mol |
| Exact Mass | 548.31 |
| IUPAC Name | [(4E,8S,9S,10E,12S,13R,14S,16R)-13,19-dihydroxy-20-(hydroxymethyl)-8,14-dimethoxy-4,10,12,16-tetramethyl-3-oxo-2-azabicyclo[16.3.1]docosa-1(22),4,10,18,20-pentaen-9-yl] carbamate |
| SMILES | CO[C@H]1C[C@H](C)Cc2cc(cc(CO)c2O)NC(=O)/C(C)=C/CC[C@H](OC)[C@@H](OC(N)=O)/C(C)=C/[C@H](C)[C@H]1O |
| InChI | InChI=1S/C29H44N2O8/c1-16-10-20-13-22(14-21(15-32)26(20)34)31-28(35)17(2)8-7-9-23(37-5)27(39-29(30)36)19(4)12-18(3)25(33)24(11-16)38-6/h8,12-14,16,18,23-25,27,32-34H,7,9-11,15H2,1-6H3,(H2,30,36)(H,31,35)/b17-8+,19-12+/t16-,18+,23+,24+,25-,27+/m1/s1 |
| InChIKey | LGAXZXAPEJTSTP-DLBIZMPSSA-N |
| XLogP | 3.57 |
| TPSA | 160.57 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.68 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|