C29H42N2O9 — CID 91525534
[(8S,9S,12S,13R,14S)-13,20,22-trihydroxy-8,14,19-trimethoxy-4,10,12,16-tetramethyl-3-oxo-2-azabicyclo[16.3.1]docosa-1(21),4,10,16,18(22),19-hexaen-9-yl] carbamate (PubChem CID 91525534) has the molecular formula C29H42N2O9 and a molecular weight of 562.66 g/mol. Its IUPAC name is [(8S,9S,12S,13R,14S)-13,20,22-trihydroxy-8,14,19-trimethoxy-4,10,12,16-tetramethyl-3-oxo-2-azabicyclo[16.3.1]docosa-1(21),4,10,16,18(22),19-hexaen-9-yl] carbamate.
| Compound Name | [(8S,9S,12S,13R,14S)-13,20,22-trihydroxy-8,14,19-trimethoxy-4,10,12,16-tetramethyl-3-oxo-2-azabicyclo[16.3.1]docosa-1(21),4,10,16,18(22),19-hexaen-9-yl] carbamate |
|---|---|
| PubChem CID | 91525534 |
| Molecular Formula | C29H42N2O9 |
| Molecular Weight | 562.66 g/mol |
| Exact Mass | 562.29 |
| IUPAC Name | [(8S,9S,12S,13R,14S)-13,20,22-trihydroxy-8,14,19-trimethoxy-4,10,12,16-tetramethyl-3-oxo-2-azabicyclo[16.3.1]docosa-1(21),4,10,16,18(22),19-hexaen-9-yl] carbamate |
| SMILES | COc1c(O)cc2c(O)c1C=C(C)C[C@H](OC)[C@H](O)[C@@H](C)C=C(C)[C@H](OC(N)=O)[C@@H](OC)CCC=C(C)C(=O)N2 |
| InChI | InChI=1S/C29H42N2O9/c1-15-11-19-25(34)20(14-21(32)27(19)39-7)31-28(35)16(2)9-8-10-22(37-5)26(40-29(30)36)18(4)13-17(3)24(33)23(12-15)38-6/h9,11,13-14,17,22-24,26,32-34H,8,10,12H2,1-7H3,(H2,30,36)(H,31,35)/t17-,22-,23-,24+,26-/m0/s1 |
| InChIKey | KMXSIVWASPNTPG-YPZWCUESSA-N |
| XLogP | 4.02 |
| TPSA | 169.80 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.66 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|