C35H52N2O12 — CID 78155427
[13-hydroxy-21-(4-hydroxy-1-methoxy-2-oxopentyl)-8,14,19-trimethoxy-4,10,12,16-tetramethyl-3,20,22-trioxo-2-azabicyclo[16.3.1]docosa-1(21),4,10,18-tetraen-9-yl] carbamate (PubChem CID 78155427) has the molecular formula C35H52N2O12 and a molecular weight of 692.80 g/mol. Its IUPAC name is [13-hydroxy-21-(4-hydroxy-1-methoxy-2-oxopentyl)-8,14,19-trimethoxy-4,10,12,16-tetramethyl-3,20,22-trioxo-2-azabicyclo[16.3.1]docosa-1(21),4,10,18-tetraen-9-yl] carbamate.
| Compound Name | [13-hydroxy-21-(4-hydroxy-1-methoxy-2-oxopentyl)-8,14,19-trimethoxy-4,10,12,16-tetramethyl-3,20,22-trioxo-2-azabicyclo[16.3.1]docosa-1(21),4,10,18-tetraen-9-yl] carbamate |
|---|---|
| PubChem CID | 78155427 |
| Molecular Formula | C35H52N2O12 |
| Molecular Weight | 692.80 g/mol |
| Exact Mass | 692.35 |
| IUPAC Name | [13-hydroxy-21-(4-hydroxy-1-methoxy-2-oxopentyl)-8,14,19-trimethoxy-4,10,12,16-tetramethyl-3,20,22-trioxo-2-azabicyclo[16.3.1]docosa-1(21),4,10,18-tetraen-9-yl] carbamate |
| SMILES | COC1=C2CC(C)CC(OC)C(O)C(C)C=C(C)C(OC(N)=O)C(OC)CCC=C(C)C(=O)NC(=C(C(OC)C(=O)CC(C)O)C1=O)C2=O |
| InChI | InChI=1S/C35H52N2O12/c1-17-13-22-29(41)27(26(30(42)32(22)47-8)33(48-9)23(39)16-21(5)38)37-34(43)18(2)11-10-12-24(45-6)31(49-35(36)44)20(4)15-19(3)28(40)25(14-17)46-7/h11,15,17,19,21,24-25,28,31,33,38,40H,10,12-14,16H2,1-9H3,(H2,36,44)(H,37,43) |
| InChIKey | IWXKDLKUMGGABM-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 210.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.80 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|