C40H52 — CID 42627620
1,3,3-trimethyl-2-[(1E,3E,7E,11E,15Z,18Z)-3,7,12,16-tetramethyl-18-(2,2,6-trimethylcyclohexylidene)octadeca-1,3,7,11,15-pentaen-5,9,13-triynyl]cyclohexene (PubChem CID 42627620) has the molecular formula C40H52 and a molecular weight of 532.86 g/mol. Its IUPAC name is 1,3,3-trimethyl-2-[(1E,3E,7E,11E,15Z,18Z)-3,7,12,16-tetramethyl-18-(2,2,6-trimethylcyclohexylidene)octadeca-1,3,7,11,15-pentaen-5,9,13-triynyl]cyclohexene.
| Compound Name | 1,3,3-trimethyl-2-[(1E,3E,7E,11E,15Z,18Z)-3,7,12,16-tetramethyl-18-(2,2,6-trimethylcyclohexylidene)octadeca-1,3,7,11,15-pentaen-5,9,13-triynyl]cyclohexene |
|---|---|
| PubChem CID | 42627620 |
| Molecular Formula | C40H52 |
| Molecular Weight | 532.86 g/mol |
| Exact Mass | 532.41 |
| IUPAC Name | 1,3,3-trimethyl-2-[(1E,3E,7E,11E,15Z,18Z)-3,7,12,16-tetramethyl-18-(2,2,6-trimethylcyclohexylidene)octadeca-1,3,7,11,15-pentaen-5,9,13-triynyl]cyclohexene |
| SMILES | CC1=C(/C=C/C(C)=C/C#C/C(C)=C/C#C/C=C(\C)C#C/C=C(/C)C/C=C2/C(C)CCCC2(C)C)C(C)(C)CCC1 |
| InChI | InChI=1S/C40H52/c1-31(19-13-21-33(3)25-27-37-35(5)23-15-29-39(37,7)8)17-11-12-18-32(2)20-14-22-34(4)26-28-38-36(6)24-16-30-40(38,9)10/h17-18,21-22,25,27-28,36H,15-16,23-24,26,29-30H2,1-10H3/b27-25+,31-17+,32-18+,33-21+,34-22-,38-28- |
| InChIKey | OWZWJWSOKOITRK-ARQRDYGJSA-N |
| XLogP | 11.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.86 |
| LogP ≤ 5 | 11.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|