C21H23NO2 — CID 42627898
(E)-N-[(1R,2R)-2-phenylmethoxy-1,2,3,4-tetrahydronaphthalen-1-yl]but-2-enamide (PubChem CID 42627898) has the molecular formula C21H23NO2 and a molecular weight of 321.42 g/mol. Its IUPAC name is (E)-N-[(1R,2R)-2-phenylmethoxy-1,2,3,4-tetrahydronaphthalen-1-yl]but-2-enamide.
| Compound Name | (E)-N-[(1R,2R)-2-phenylmethoxy-1,2,3,4-tetrahydronaphthalen-1-yl]but-2-enamide |
|---|---|
| PubChem CID | 42627898 |
| Molecular Formula | C21H23NO2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | (E)-N-[(1R,2R)-2-phenylmethoxy-1,2,3,4-tetrahydronaphthalen-1-yl]but-2-enamide |
| SMILES | C/C=C/C(=O)N[C@@H]1c2ccccc2CC[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C21H23NO2/c1-2-8-20(23)22-21-18-12-7-6-11-17(18)13-14-19(21)24-15-16-9-4-3-5-10-16/h2-12,19,21H,13-15H2,1H3,(H,22,23)/b8-2+/t19-,21-/m1/s1 |
| InChIKey | LHABXAXEZUENHS-QKHDBXIKSA-N |
| XLogP | 3.95 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|