C16H12F2N2O2S — CID 42630781
3-anilino-5-(3,5-difluorophenyl)-5-methyl-2-sulfanylidene-1,3-oxazolidin-4-one (PubChem CID 42630781) has the molecular formula C16H12F2N2O2S and a molecular weight of 334.35 g/mol. Its IUPAC name is 3-anilino-5-(3,5-difluorophenyl)-5-methyl-2-sulfanylidene-1,3-oxazolidin-4-one.
| Compound Name | 3-anilino-5-(3,5-difluorophenyl)-5-methyl-2-sulfanylidene-1,3-oxazolidin-4-one |
|---|---|
| PubChem CID | 42630781 |
| Molecular Formula | C16H12F2N2O2S |
| Molecular Weight | 334.35 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | 3-anilino-5-(3,5-difluorophenyl)-5-methyl-2-sulfanylidene-1,3-oxazolidin-4-one |
| SMILES | CC1(c2cc(F)cc(F)c2)OC(=S)N(Nc2ccccc2)C1=O |
| InChI | InChI=1S/C16H12F2N2O2S/c1-16(10-7-11(17)9-12(18)8-10)14(21)20(15(23)22-16)19-13-5-3-2-4-6-13/h2-9,19H,1H3 |
| InChIKey | FGCCHHHDQIVQKW-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.35 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|