C30H16F10N4O6S2 — CID 42631207
N-[[[N-[(2,6-difluorobenzoyl)carbamoyl]-4-(trifluoromethoxy)anilino]disulfanyl]-[4-(trifluoromethoxy)phenyl]carbamoyl]-2,6-difluorobenzamide (PubChem CID 42631207) has the molecular formula C30H16F10N4O6S2 and a molecular weight of 782.59 g/mol. Its IUPAC name is N-[[[N-[(2,6-difluorobenzoyl)carbamoyl]-4-(trifluoromethoxy)anilino]disulfanyl]-[4-(trifluoromethoxy)phenyl]carbamoyl]-2,6-difluorobenzamide.
| Compound Name | N-[[[N-[(2,6-difluorobenzoyl)carbamoyl]-4-(trifluoromethoxy)anilino]disulfanyl]-[4-(trifluoromethoxy)phenyl]carbamoyl]-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 42631207 |
| Molecular Formula | C30H16F10N4O6S2 |
| Molecular Weight | 782.59 g/mol |
| Exact Mass | 782.04 |
| IUPAC Name | N-[[[N-[(2,6-difluorobenzoyl)carbamoyl]-4-(trifluoromethoxy)anilino]disulfanyl]-[4-(trifluoromethoxy)phenyl]carbamoyl]-2,6-difluorobenzamide |
| SMILES | O=C(NC(=O)N(SSN(C(=O)NC(=O)c1c(F)cccc1F)c1ccc(OC(F)(F)F)cc1)c1ccc(OC(F)(F)F)cc1)c1c(F)cccc1F |
| InChI | InChI=1S/C30H16F10N4O6S2/c31-19-3-1-4-20(32)23(19)25(45)41-27(47)43(15-7-11-17(12-8-15)49-29(35,36)37)51-52-44(16-9-13-18(14-10-16)50-30(38,39)40)28(48)42-26(46)24-21(33)5-2-6-22(24)34/h1-14H,(H,41,45,47)(H,42,46,48) |
| InChIKey | NOHKGPDVRKULMW-UHFFFAOYSA-N |
| XLogP | 8.66 |
| TPSA | 117.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.59 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|