C25H42O5Si — CID 42631872
[(E,2R)-1-[tert-butyl(dimethyl)silyl]oxy-4-methylidene-7-(oxan-2-yloxy)hept-5-en-2-yl] hex-4-ynoate (PubChem CID 42631872) has the molecular formula C25H42O5Si and a molecular weight of 450.69 g/mol. Its IUPAC name is [(E,2R)-1-[tert-butyl(dimethyl)silyl]oxy-4-methylidene-7-(oxan-2-yloxy)hept-5-en-2-yl] hex-4-ynoate.
| Compound Name | [(E,2R)-1-[tert-butyl(dimethyl)silyl]oxy-4-methylidene-7-(oxan-2-yloxy)hept-5-en-2-yl] hex-4-ynoate |
|---|---|
| PubChem CID | 42631872 |
| Molecular Formula | C25H42O5Si |
| Molecular Weight | 450.69 g/mol |
| Exact Mass | 450.28 |
| IUPAC Name | [(E,2R)-1-[tert-butyl(dimethyl)silyl]oxy-4-methylidene-7-(oxan-2-yloxy)hept-5-en-2-yl] hex-4-ynoate |
| SMILES | C=C(/C=C/COC1CCCCO1)C[C@H](CO[Si](C)(C)C(C)(C)C)OC(=O)CCC#CC |
| InChI | InChI=1S/C25H42O5Si/c1-8-9-10-15-23(26)30-22(20-29-31(6,7)25(3,4)5)19-21(2)14-13-18-28-24-16-11-12-17-27-24/h13-14,22,24H,2,10-12,15-20H2,1,3-7H3/b14-13+/t22-,24?/m1/s1 |
| InChIKey | CSCIJZJBBTUYMC-LLCCEBCLSA-N |
| XLogP | 5.77 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.69 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|