C24H26F3N3O2S — CID 42635204
N-[3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]propyl]naphthalene-2-sulfonamide (PubChem CID 42635204) has the molecular formula C24H26F3N3O2S and a molecular weight of 477.55 g/mol. Its IUPAC name is N-[3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]propyl]naphthalene-2-sulfonamide.
| Compound Name | N-[3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]propyl]naphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 42635204 |
| Molecular Formula | C24H26F3N3O2S |
| Molecular Weight | 477.55 g/mol |
| Exact Mass | 477.17 |
| IUPAC Name | N-[3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]propyl]naphthalene-2-sulfonamide |
| SMILES | O=S(=O)(NCCCN1CCN(c2cccc(C(F)(F)F)c2)CC1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C24H26F3N3O2S/c25-24(26,27)21-7-3-8-22(18-21)30-15-13-29(14-16-30)12-4-11-28-33(31,32)23-10-9-19-5-1-2-6-20(19)17-23/h1-3,5-10,17-18,28H,4,11-16H2 |
| InChIKey | PVIMMAOWNLCQJD-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.55 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|