C31H38N2O7S — CID 42636544
tert-butyl (1R,9S,12S)-4-methoxy-12-(2-methoxy-2-oxoethyl)-13-methylidene-16-(4-methylphenyl)sulfonyl-8,16-diazatetracyclo[7.4.3.01,9.02,7]hexadeca-2(7),3,5-triene-8-carboxylate (PubChem CID 42636544) has the molecular formula C31H38N2O7S and a molecular weight of 582.72 g/mol. Its IUPAC name is tert-butyl (1R,9S,12S)-4-methoxy-12-(2-methoxy-2-oxoethyl)-13-methylidene-16-(4-methylphenyl)sulfonyl-8,16-diazatetracyclo[7.4.3.01,9.02,7]hexadeca-2(7),3,5-triene-8-carboxylate.
| Compound Name | tert-butyl (1R,9S,12S)-4-methoxy-12-(2-methoxy-2-oxoethyl)-13-methylidene-16-(4-methylphenyl)sulfonyl-8,16-diazatetracyclo[7.4.3.01,9.02,7]hexadeca-2(7),3,5-triene-8-carboxylate |
|---|---|
| PubChem CID | 42636544 |
| Molecular Formula | C31H38N2O7S |
| Molecular Weight | 582.72 g/mol |
| Exact Mass | 582.24 |
| IUPAC Name | tert-butyl (1R,9S,12S)-4-methoxy-12-(2-methoxy-2-oxoethyl)-13-methylidene-16-(4-methylphenyl)sulfonyl-8,16-diazatetracyclo[7.4.3.01,9.02,7]hexadeca-2(7),3,5-triene-8-carboxylate |
| SMILES | C=C1[C@H](CC(=O)OC)CC[C@@]23N(C(=O)OC(C)(C)C)c4ccc(OC)cc4[C@@]12CCN3S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C31H38N2O7S/c1-20-8-11-24(12-9-20)41(36,37)32-17-16-30-21(2)22(18-27(34)39-7)14-15-31(30,32)33(28(35)40-29(3,4)5)26-13-10-23(38-6)19-25(26)30/h8-13,19,22H,2,14-18H2,1,3-7H3/t22-,30+,31+/m0/s1 |
| InChIKey | NMWOPTCQEGXGJS-PWUXPHIYSA-N |
| XLogP | 5.32 |
| TPSA | 102.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.72 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|