C20H15NO2 — CID 42639188
1-methyl-4,5-diphenylpyrano[3,4-b]pyrrol-7-one (PubChem CID 42639188) has the molecular formula C20H15NO2 and a molecular weight of 301.35 g/mol. Its IUPAC name is 1-methyl-4,5-diphenylpyrano[3,4-b]pyrrol-7-one.
| Compound Name | 1-methyl-4,5-diphenylpyrano[3,4-b]pyrrol-7-one |
|---|---|
| PubChem CID | 42639188 |
| Molecular Formula | C20H15NO2 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | 1-methyl-4,5-diphenylpyrano[3,4-b]pyrrol-7-one |
| SMILES | Cn1ccc2c(-c3ccccc3)c(-c3ccccc3)oc(=O)c21 |
| InChI | InChI=1S/C20H15NO2/c1-21-13-12-16-17(14-8-4-2-5-9-14)19(23-20(22)18(16)21)15-10-6-3-7-11-15/h2-13H,1H3 |
| InChIKey | IBIBWWDLFVHWAE-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 35.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |