C11H16N6O5 — CID 42641668
5-(diaminomethylideneamino)-2-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]pentanoic acid (PubChem CID 42641668) has the molecular formula C11H16N6O5 and a molecular weight of 312.29 g/mol. Its IUPAC name is 5-(diaminomethylideneamino)-2-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]pentanoic acid.
| Compound Name | 5-(diaminomethylideneamino)-2-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 42641668 |
| Molecular Formula | C11H16N6O5 |
| Molecular Weight | 312.29 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | 5-(diaminomethylideneamino)-2-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]pentanoic acid |
| SMILES | NC(N)=NCCCC(NC(=O)c1cc(=O)[nH]c(=O)[nH]1)C(=O)O |
| InChI | InChI=1S/C11H16N6O5/c12-10(13)14-3-1-2-5(9(20)21)15-8(19)6-4-7(18)17-11(22)16-6/h4-5H,1-3H2,(H,15,19)(H,20,21)(H4,12,13,14)(H2,16,17,18,22) |
| InChIKey | ZETSUZUWGXXIGU-UHFFFAOYSA-N |
| XLogP | -2.70 |
| TPSA | 196.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.29 |
| LogP ≤ 5 | -2.70 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|