C12H17N5O5 — CID 69126400
(2S)-5-(diaminomethylideneamino)-2-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]pentanoic acid (PubChem CID 69126400) has the molecular formula C12H17N5O5 and a molecular weight of 311.30 g/mol. Its IUPAC name is (2S)-5-(diaminomethylideneamino)-2-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]pentanoic acid.
| Compound Name | (2S)-5-(diaminomethylideneamino)-2-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 69126400 |
| Molecular Formula | C12H17N5O5 |
| Molecular Weight | 311.30 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | (2S)-5-(diaminomethylideneamino)-2-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]pentanoic acid |
| SMILES | NC(N)=NCCC[C@H](NC(=O)CN1C(=O)C=CC1=O)C(=O)O |
| InChI | InChI=1S/C12H17N5O5/c13-12(14)15-5-1-2-7(11(21)22)16-8(18)6-17-9(19)3-4-10(17)20/h3-4,7H,1-2,5-6H2,(H,16,18)(H,21,22)(H4,13,14,15)/t7-/m0/s1 |
| InChIKey | ZUPAZSORQOEYJP-ZETCQYMHSA-N |
| XLogP | -2.47 |
| TPSA | 168.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.30 |
| LogP ≤ 5 | -2.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|