C16H24N4O6 — CID 66993002
(2S)-5-(carbamoylamino)-2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]pentanoic acid (PubChem CID 66993002) has the molecular formula C16H24N4O6 and a molecular weight of 368.39 g/mol. Its IUPAC name is (2S)-5-(carbamoylamino)-2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]pentanoic acid.
| Compound Name | (2S)-5-(carbamoylamino)-2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]pentanoic acid |
|---|---|
| PubChem CID | 66993002 |
| Molecular Formula | C16H24N4O6 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | (2S)-5-(carbamoylamino)-2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]pentanoic acid |
| SMILES | NC(=O)NCCC[C@H](NC(=O)CCCCCN1C(=O)C=CC1=O)C(=O)O |
| InChI | InChI=1S/C16H24N4O6/c17-16(26)18-9-4-5-11(15(24)25)19-12(21)6-2-1-3-10-20-13(22)7-8-14(20)23/h7-8,11H,1-6,9-10H2,(H,19,21)(H,24,25)(H3,17,18,26)/t11-/m0/s1 |
| InChIKey | YPHPVMCROCWJJL-NSHDSACASA-N |
| XLogP | -0.51 |
| TPSA | 158.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|