C26H26N2O5 — CID 42642077
2-cyclohexyl-2-hydroxy-4-(4-methoxyphenyl)-N-(4-methyl-1-oxo-2,3-benzoxazin-6-yl)but-3-ynamide (PubChem CID 42642077) has the molecular formula C26H26N2O5 and a molecular weight of 446.50 g/mol. Its IUPAC name is 2-cyclohexyl-2-hydroxy-4-(4-methoxyphenyl)-N-(4-methyl-1-oxo-2,3-benzoxazin-6-yl)but-3-ynamide.
| Compound Name | 2-cyclohexyl-2-hydroxy-4-(4-methoxyphenyl)-N-(4-methyl-1-oxo-2,3-benzoxazin-6-yl)but-3-ynamide |
|---|---|
| PubChem CID | 42642077 |
| Molecular Formula | C26H26N2O5 |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | 2-cyclohexyl-2-hydroxy-4-(4-methoxyphenyl)-N-(4-methyl-1-oxo-2,3-benzoxazin-6-yl)but-3-ynamide |
| SMILES | COc1ccc(C#CC(O)(C(=O)Nc2ccc3c(=O)onc(C)c3c2)C2CCCCC2)cc1 |
| InChI | InChI=1S/C26H26N2O5/c1-17-23-16-20(10-13-22(23)24(29)33-28-17)27-25(30)26(31,19-6-4-3-5-7-19)15-14-18-8-11-21(32-2)12-9-18/h8-13,16,19,31H,3-7H2,1-2H3,(H,27,30) |
| InChIKey | XKWYGEMMVLRJPI-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 101.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|