C19H25N5O2 — CID 42642203
2-(2-nitrophenyl)-N-(2,2,6,6-tetramethylpiperidin-4-yl)pyrimidin-4-amine (PubChem CID 42642203) has the molecular formula C19H25N5O2 and a molecular weight of 355.44 g/mol. Its IUPAC name is 2-(2-nitrophenyl)-N-(2,2,6,6-tetramethylpiperidin-4-yl)pyrimidin-4-amine.
| Compound Name | 2-(2-nitrophenyl)-N-(2,2,6,6-tetramethylpiperidin-4-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 42642203 |
| Molecular Formula | C19H25N5O2 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.20 |
| IUPAC Name | 2-(2-nitrophenyl)-N-(2,2,6,6-tetramethylpiperidin-4-yl)pyrimidin-4-amine |
| SMILES | CC1(C)CC(Nc2ccnc(-c3ccccc3[N+](=O)[O-])n2)CC(C)(C)N1 |
| InChI | InChI=1S/C19H25N5O2/c1-18(2)11-13(12-19(3,4)23-18)21-16-9-10-20-17(22-16)14-7-5-6-8-15(14)24(25)26/h5-10,13,23H,11-12H2,1-4H3,(H,20,21,22) |
| InChIKey | GVTYDXMKWCHAKJ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 92.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|