C33H27N3O3S — CID 42643581
3,3-bis(5-methyl-1H-indol-3-yl)-1-(4-methylphenyl)sulfonylindol-2-one (PubChem CID 42643581) has the molecular formula C33H27N3O3S and a molecular weight of 545.66 g/mol. Its IUPAC name is 3,3-bis(5-methyl-1H-indol-3-yl)-1-(4-methylphenyl)sulfonylindol-2-one.
| Compound Name | 3,3-bis(5-methyl-1H-indol-3-yl)-1-(4-methylphenyl)sulfonylindol-2-one |
|---|---|
| PubChem CID | 42643581 |
| Molecular Formula | C33H27N3O3S |
| Molecular Weight | 545.66 g/mol |
| Exact Mass | 545.18 |
| IUPAC Name | 3,3-bis(5-methyl-1H-indol-3-yl)-1-(4-methylphenyl)sulfonylindol-2-one |
| SMILES | Cc1ccc(S(=O)(=O)N2C(=O)C(c3c[nH]c4ccc(C)cc34)(c3c[nH]c4ccc(C)cc34)c3ccccc32)cc1 |
| InChI | InChI=1S/C33H27N3O3S/c1-20-8-12-23(13-9-20)40(38,39)36-31-7-5-4-6-26(31)33(32(36)37,27-18-34-29-14-10-21(2)16-24(27)29)28-19-35-30-15-11-22(3)17-25(28)30/h4-19,34-35H,1-3H3 |
| InChIKey | BSABKPDFLOBPQS-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 86.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.66 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |