C21H13F3N2O2 — CID 42643617
3-[2-phenyl-5-(trifluoromethyl)benzimidazol-1-yl]benzoic acid (PubChem CID 42643617) has the molecular formula C21H13F3N2O2 and a molecular weight of 382.34 g/mol. Its IUPAC name is 3-[2-phenyl-5-(trifluoromethyl)benzimidazol-1-yl]benzoic acid.
| Compound Name | 3-[2-phenyl-5-(trifluoromethyl)benzimidazol-1-yl]benzoic acid |
|---|---|
| PubChem CID | 42643617 |
| Molecular Formula | C21H13F3N2O2 |
| Molecular Weight | 382.34 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | 3-[2-phenyl-5-(trifluoromethyl)benzimidazol-1-yl]benzoic acid |
| SMILES | O=C(O)c1cccc(-n2c(-c3ccccc3)nc3cc(C(F)(F)F)ccc32)c1 |
| InChI | InChI=1S/C21H13F3N2O2/c22-21(23,24)15-9-10-18-17(12-15)25-19(13-5-2-1-3-6-13)26(18)16-8-4-7-14(11-16)20(27)28/h1-12H,(H,27,28) |
| InChIKey | YWPUFRPMQLPAIJ-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.34 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |