C21H12F4N2O2 — CID 58516960
3-[2-(3-fluorophenyl)-5-(trifluoromethyl)benzimidazol-1-yl]benzoic acid (PubChem CID 58516960) has the molecular formula C21H12F4N2O2 and a molecular weight of 400.33 g/mol. Its IUPAC name is 3-[2-(3-fluorophenyl)-5-(trifluoromethyl)benzimidazol-1-yl]benzoic acid.
| Compound Name | 3-[2-(3-fluorophenyl)-5-(trifluoromethyl)benzimidazol-1-yl]benzoic acid |
|---|---|
| PubChem CID | 58516960 |
| Molecular Formula | C21H12F4N2O2 |
| Molecular Weight | 400.33 g/mol |
| Exact Mass | 400.08 |
| IUPAC Name | 3-[2-(3-fluorophenyl)-5-(trifluoromethyl)benzimidazol-1-yl]benzoic acid |
| SMILES | O=C(O)c1cccc(-n2c(-c3cccc(F)c3)nc3cc(C(F)(F)F)ccc32)c1 |
| InChI | InChI=1S/C21H12F4N2O2/c22-15-5-1-3-12(9-15)19-26-17-11-14(21(23,24)25)7-8-18(17)27(19)16-6-2-4-13(10-16)20(28)29/h1-11H,(H,28,29) |
| InChIKey | APYXOQAZKIQWKR-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.33 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |