C25H22BrN3O6 — CID 4264776
[4-bromo-2-[[[2-[[2-(4-methoxyphenyl)acetyl]amino]acetyl]hydrazinylidene]methyl]phenyl] 3-(furan-2-yl)prop-2-enoate (PubChem CID 4264776) has the molecular formula C25H22BrN3O6 and a molecular weight of 540.37 g/mol. Its IUPAC name is [4-bromo-2-[[[2-[[2-(4-methoxyphenyl)acetyl]amino]acetyl]hydrazinylidene]methyl]phenyl] 3-(furan-2-yl)prop-2-enoate.
| Compound Name | [4-bromo-2-[[[2-[[2-(4-methoxyphenyl)acetyl]amino]acetyl]hydrazinylidene]methyl]phenyl] 3-(furan-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 4264776 |
| Molecular Formula | C25H22BrN3O6 |
| Molecular Weight | 540.37 g/mol |
| Exact Mass | 539.07 |
| IUPAC Name | [4-bromo-2-[[[2-[[2-(4-methoxyphenyl)acetyl]amino]acetyl]hydrazinylidene]methyl]phenyl] 3-(furan-2-yl)prop-2-enoate |
| SMILES | COc1ccc(CC(=O)NCC(=O)NN=Cc2cc(Br)ccc2OC(=O)C=Cc2ccco2)cc1 |
| InChI | InChI=1S/C25H22BrN3O6/c1-33-20-7-4-17(5-8-20)13-23(30)27-16-24(31)29-28-15-18-14-19(26)6-10-22(18)35-25(32)11-9-21-3-2-12-34-21/h2-12,14-15H,13,16H2,1H3,(H,27,30)(H,29,31) |
| InChIKey | XCSULDFZGZDCKN-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 119.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.37 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|