C24H20BrN3O6 — CID 3728518
[4-bromo-2-[[[2-[(2-methoxybenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] 3-(furan-2-yl)prop-2-enoate (PubChem CID 3728518) has the molecular formula C24H20BrN3O6 and a molecular weight of 526.34 g/mol. Its IUPAC name is [4-bromo-2-[[[2-[(2-methoxybenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] 3-(furan-2-yl)prop-2-enoate.
| Compound Name | [4-bromo-2-[[[2-[(2-methoxybenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] 3-(furan-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 3728518 |
| Molecular Formula | C24H20BrN3O6 |
| Molecular Weight | 526.34 g/mol |
| Exact Mass | 525.05 |
| IUPAC Name | [4-bromo-2-[[[2-[(2-methoxybenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] 3-(furan-2-yl)prop-2-enoate |
| SMILES | COc1ccccc1C(=O)NCC(=O)NN=Cc1cc(Br)ccc1OC(=O)C=Cc1ccco1 |
| InChI | InChI=1S/C24H20BrN3O6/c1-32-21-7-3-2-6-19(21)24(31)26-15-22(29)28-27-14-16-13-17(25)8-10-20(16)34-23(30)11-9-18-5-4-12-33-18/h2-14H,15H2,1H3,(H,26,31)(H,28,29) |
| InChIKey | FCLQUXOJSYKQGL-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 119.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.34 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|