C19H22N4O5S — CID 42652919
N-(1,1-dioxothiolan-3-yl)-2-[4-(1H-indole-3-carbonyl)piperazin-1-yl]-2-oxoacetamide (PubChem CID 42652919) has the molecular formula C19H22N4O5S and a molecular weight of 418.48 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-2-[4-(1H-indole-3-carbonyl)piperazin-1-yl]-2-oxoacetamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-2-[4-(1H-indole-3-carbonyl)piperazin-1-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 42652919 |
| Molecular Formula | C19H22N4O5S |
| Molecular Weight | 418.48 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-2-[4-(1H-indole-3-carbonyl)piperazin-1-yl]-2-oxoacetamide |
| SMILES | O=C(NC1CCS(=O)(=O)C1)C(=O)N1CCN(C(=O)c2c[nH]c3ccccc23)CC1 |
| InChI | InChI=1S/C19H22N4O5S/c24-17(21-13-5-10-29(27,28)12-13)19(26)23-8-6-22(7-9-23)18(25)15-11-20-16-4-2-1-3-14(15)16/h1-4,11,13,20H,5-10,12H2,(H,21,24) |
| InChIKey | GQBZJCXLMRGWAK-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 119.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.48 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|