C21H20N2O4S2 — CID 42654468
2-[(5,6-dimethoxy-3-oxo-1,2-dihydroinden-2-yl)sulfanyl]-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 42654468) has the molecular formula C21H20N2O4S2 and a molecular weight of 428.54 g/mol. Its IUPAC name is 2-[(5,6-dimethoxy-3-oxo-1,2-dihydroinden-2-yl)sulfanyl]-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 2-[(5,6-dimethoxy-3-oxo-1,2-dihydroinden-2-yl)sulfanyl]-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 42654468 |
| Molecular Formula | C21H20N2O4S2 |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.09 |
| IUPAC Name | 2-[(5,6-dimethoxy-3-oxo-1,2-dihydroinden-2-yl)sulfanyl]-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | COc1cc2c(cc1OC)C(=O)C(Sc1nc3sc4c(c3c(=O)[nH]1)CCCC4)C2 |
| InChI | InChI=1S/C21H20N2O4S2/c1-26-13-7-10-8-16(18(24)12(10)9-14(13)27-2)29-21-22-19(25)17-11-5-3-4-6-15(11)28-20(17)23-21/h7,9,16H,3-6,8H2,1-2H3,(H,22,23,25) |
| InChIKey | TWDZNXLQYQHOPW-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 81.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |