C22H25NO4 — CID 42654758
3-(4-benzylpiperidin-1-yl)-6,7-dimethoxy-3H-2-benzofuran-1-one (PubChem CID 42654758) has the molecular formula C22H25NO4 and a molecular weight of 367.45 g/mol. Its IUPAC name is 3-(4-benzylpiperidin-1-yl)-6,7-dimethoxy-3H-2-benzofuran-1-one.
| Compound Name | 3-(4-benzylpiperidin-1-yl)-6,7-dimethoxy-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 42654758 |
| Molecular Formula | C22H25NO4 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | 3-(4-benzylpiperidin-1-yl)-6,7-dimethoxy-3H-2-benzofuran-1-one |
| SMILES | COc1ccc2c(c1OC)C(=O)OC2N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C22H25NO4/c1-25-18-9-8-17-19(20(18)26-2)22(24)27-21(17)23-12-10-16(11-13-23)14-15-6-4-3-5-7-15/h3-9,16,21H,10-14H2,1-2H3 |
| InChIKey | QVONDTDLCIJBGR-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |