C24H30N2O5 — CID 42666698
ethyl 4-[2-[(3-methoxybenzoyl)-prop-2-enylamino]propanoyl]-1,3,5-trimethylpyrrole-2-carboxylate (PubChem CID 42666698) has the molecular formula C24H30N2O5 and a molecular weight of 426.51 g/mol. Its IUPAC name is ethyl 4-[2-[(3-methoxybenzoyl)-prop-2-enylamino]propanoyl]-1,3,5-trimethylpyrrole-2-carboxylate.
| Compound Name | ethyl 4-[2-[(3-methoxybenzoyl)-prop-2-enylamino]propanoyl]-1,3,5-trimethylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 42666698 |
| Molecular Formula | C24H30N2O5 |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | ethyl 4-[2-[(3-methoxybenzoyl)-prop-2-enylamino]propanoyl]-1,3,5-trimethylpyrrole-2-carboxylate |
| SMILES | C=CCN(C(=O)c1cccc(OC)c1)C(C)C(=O)c1c(C)c(C(=O)OCC)n(C)c1C |
| InChI | InChI=1S/C24H30N2O5/c1-8-13-26(23(28)18-11-10-12-19(14-18)30-7)17(5)22(27)20-15(3)21(24(29)31-9-2)25(6)16(20)4/h8,10-12,14,17H,1,9,13H2,2-7H3 |
| InChIKey | OHKHVNLNRAGHRG-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 77.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|