C24H29ClN2O4 — CID 42674986
ethyl 4-[2-[(4-chlorobenzoyl)-prop-2-enylamino]propanoyl]-1-ethyl-3,5-dimethylpyrrole-2-carboxylate (PubChem CID 42674986) has the molecular formula C24H29ClN2O4 and a molecular weight of 444.96 g/mol. Its IUPAC name is ethyl 4-[2-[(4-chlorobenzoyl)-prop-2-enylamino]propanoyl]-1-ethyl-3,5-dimethylpyrrole-2-carboxylate.
| Compound Name | ethyl 4-[2-[(4-chlorobenzoyl)-prop-2-enylamino]propanoyl]-1-ethyl-3,5-dimethylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 42674986 |
| Molecular Formula | C24H29ClN2O4 |
| Molecular Weight | 444.96 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | ethyl 4-[2-[(4-chlorobenzoyl)-prop-2-enylamino]propanoyl]-1-ethyl-3,5-dimethylpyrrole-2-carboxylate |
| SMILES | C=CCN(C(=O)c1ccc(Cl)cc1)C(C)C(=O)c1c(C)c(C(=O)OCC)n(CC)c1C |
| InChI | InChI=1S/C24H29ClN2O4/c1-7-14-27(23(29)18-10-12-19(25)13-11-18)17(6)22(28)20-15(4)21(24(30)31-9-3)26(8-2)16(20)5/h7,10-13,17H,1,8-9,14H2,2-6H3 |
| InChIKey | CRGBJKQLYVBPEY-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 68.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.96 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|