C24H31ClN2O5 — CID 42679428
methyl 4-[2-[(4-chlorobenzoyl)-(3-methoxypropyl)amino]propanoyl]-1-ethyl-3,5-dimethylpyrrole-2-carboxylate (PubChem CID 42679428) has the molecular formula C24H31ClN2O5 and a molecular weight of 462.97 g/mol. Its IUPAC name is methyl 4-[2-[(4-chlorobenzoyl)-(3-methoxypropyl)amino]propanoyl]-1-ethyl-3,5-dimethylpyrrole-2-carboxylate.
| Compound Name | methyl 4-[2-[(4-chlorobenzoyl)-(3-methoxypropyl)amino]propanoyl]-1-ethyl-3,5-dimethylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 42679428 |
| Molecular Formula | C24H31ClN2O5 |
| Molecular Weight | 462.97 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | methyl 4-[2-[(4-chlorobenzoyl)-(3-methoxypropyl)amino]propanoyl]-1-ethyl-3,5-dimethylpyrrole-2-carboxylate |
| SMILES | CCn1c(C)c(C(=O)C(C)N(CCCOC)C(=O)c2ccc(Cl)cc2)c(C)c1C(=O)OC |
| InChI | InChI=1S/C24H31ClN2O5/c1-7-26-16(3)20(15(2)21(26)24(30)32-6)22(28)17(4)27(13-8-14-31-5)23(29)18-9-11-19(25)12-10-18/h9-12,17H,7-8,13-14H2,1-6H3 |
| InChIKey | JFGUSJVVKYHZCI-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 77.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.97 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|