C23H27ClN2O4 — CID 42679516
methyl 4-[2-[(4-chlorobenzoyl)-prop-2-enylamino]propanoyl]-1-ethyl-3,5-dimethylpyrrole-2-carboxylate (PubChem CID 42679516) has the molecular formula C23H27ClN2O4 and a molecular weight of 430.93 g/mol. Its IUPAC name is methyl 4-[2-[(4-chlorobenzoyl)-prop-2-enylamino]propanoyl]-1-ethyl-3,5-dimethylpyrrole-2-carboxylate.
| Compound Name | methyl 4-[2-[(4-chlorobenzoyl)-prop-2-enylamino]propanoyl]-1-ethyl-3,5-dimethylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 42679516 |
| Molecular Formula | C23H27ClN2O4 |
| Molecular Weight | 430.93 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | methyl 4-[2-[(4-chlorobenzoyl)-prop-2-enylamino]propanoyl]-1-ethyl-3,5-dimethylpyrrole-2-carboxylate |
| SMILES | C=CCN(C(=O)c1ccc(Cl)cc1)C(C)C(=O)c1c(C)c(C(=O)OC)n(CC)c1C |
| InChI | InChI=1S/C23H27ClN2O4/c1-7-13-26(22(28)17-9-11-18(24)12-10-17)16(5)21(27)19-14(3)20(23(29)30-6)25(8-2)15(19)4/h7,9-12,16H,1,8,13H2,2-6H3 |
| InChIKey | BQUSZMNLRSCOEQ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 68.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.93 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|