C25H33ClN2O5 — CID 42679485
methyl 4-[2-[(4-chlorobenzoyl)-(3-ethoxypropyl)amino]propanoyl]-1-ethyl-3,5-dimethylpyrrole-2-carboxylate (PubChem CID 42679485) has the molecular formula C25H33ClN2O5 and a molecular weight of 477.00 g/mol. Its IUPAC name is methyl 4-[2-[(4-chlorobenzoyl)-(3-ethoxypropyl)amino]propanoyl]-1-ethyl-3,5-dimethylpyrrole-2-carboxylate.
| Compound Name | methyl 4-[2-[(4-chlorobenzoyl)-(3-ethoxypropyl)amino]propanoyl]-1-ethyl-3,5-dimethylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 42679485 |
| Molecular Formula | C25H33ClN2O5 |
| Molecular Weight | 477.00 g/mol |
| Exact Mass | 476.21 |
| IUPAC Name | methyl 4-[2-[(4-chlorobenzoyl)-(3-ethoxypropyl)amino]propanoyl]-1-ethyl-3,5-dimethylpyrrole-2-carboxylate |
| SMILES | CCOCCCN(C(=O)c1ccc(Cl)cc1)C(C)C(=O)c1c(C)c(C(=O)OC)n(CC)c1C |
| InChI | InChI=1S/C25H33ClN2O5/c1-7-27-17(4)21(16(3)22(27)25(31)32-6)23(29)18(5)28(14-9-15-33-8-2)24(30)19-10-12-20(26)13-11-19/h10-13,18H,7-9,14-15H2,1-6H3 |
| InChIKey | LZTOAPRPVNJPSS-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 77.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.00 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|