C23H29ClN2O5 — CID 93141686
methyl 4-[(2S)-2-[(4-chlorobenzoyl)-(3-ethoxypropyl)amino]propanoyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate (PubChem CID 93141686) has the molecular formula C23H29ClN2O5 and a molecular weight of 448.95 g/mol. Its IUPAC name is methyl 4-[(2S)-2-[(4-chlorobenzoyl)-(3-ethoxypropyl)amino]propanoyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate.
| Compound Name | methyl 4-[(2S)-2-[(4-chlorobenzoyl)-(3-ethoxypropyl)amino]propanoyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 93141686 |
| Molecular Formula | C23H29ClN2O5 |
| Molecular Weight | 448.95 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | methyl 4-[(2S)-2-[(4-chlorobenzoyl)-(3-ethoxypropyl)amino]propanoyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate |
| SMILES | CCOCCCN(C(=O)c1ccc(Cl)cc1)[C@@H](C)C(=O)c1c(C)[nH]c(C(=O)OC)c1C |
| InChI | InChI=1S/C23H29ClN2O5/c1-6-31-13-7-12-26(22(28)17-8-10-18(24)11-9-17)16(4)21(27)19-14(2)20(23(29)30-5)25-15(19)3/h8-11,16,25H,6-7,12-13H2,1-5H3/t16-/m0/s1 |
| InChIKey | ODMVNWADSAHYOO-INIZCTEOSA-N |
| XLogP | 4.21 |
| TPSA | 88.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.95 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|