C22H27ClN2O5 — CID 83283883
methyl 4-[2-[(2-chlorobenzoyl)-(3-methoxypropyl)amino]propanoyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate (PubChem CID 83283883) has the molecular formula C22H27ClN2O5 and a molecular weight of 434.92 g/mol. Its IUPAC name is methyl 4-[2-[(2-chlorobenzoyl)-(3-methoxypropyl)amino]propanoyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate.
| Compound Name | methyl 4-[2-[(2-chlorobenzoyl)-(3-methoxypropyl)amino]propanoyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 83283883 |
| Molecular Formula | C22H27ClN2O5 |
| Molecular Weight | 434.92 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | methyl 4-[2-[(2-chlorobenzoyl)-(3-methoxypropyl)amino]propanoyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate |
| SMILES | COCCCN(C(=O)c1ccccc1Cl)C(C)C(=O)c1c(C)[nH]c(C(=O)OC)c1C |
| InChI | InChI=1S/C22H27ClN2O5/c1-13-18(14(2)24-19(13)22(28)30-5)20(26)15(3)25(11-8-12-29-4)21(27)16-9-6-7-10-17(16)23/h6-7,9-10,15,24H,8,11-12H2,1-5H3 |
| InChIKey | WXIXVOSGZFAJFN-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 88.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.92 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|