C21H34N2O5 — CID 42822503
ethyl 4-[2-[3-methoxypropyl(3-methylbutanoyl)amino]propanoyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate (PubChem CID 42822503) has the molecular formula C21H34N2O5 and a molecular weight of 394.51 g/mol. Its IUPAC name is ethyl 4-[2-[3-methoxypropyl(3-methylbutanoyl)amino]propanoyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate.
| Compound Name | ethyl 4-[2-[3-methoxypropyl(3-methylbutanoyl)amino]propanoyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 42822503 |
| Molecular Formula | C21H34N2O5 |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.25 |
| IUPAC Name | ethyl 4-[2-[3-methoxypropyl(3-methylbutanoyl)amino]propanoyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]c(C)c(C(=O)C(C)N(CCCOC)C(=O)CC(C)C)c1C |
| InChI | InChI=1S/C21H34N2O5/c1-8-28-21(26)19-14(4)18(15(5)22-19)20(25)16(6)23(10-9-11-27-7)17(24)12-13(2)3/h13,16,22H,8-12H2,1-7H3 |
| InChIKey | VJJNUFNTJSUKIO-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 88.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|