C23H32N2O6S — CID 42674558
ethyl 4-[2-[3-methoxypropyl-(4-methylphenyl)sulfonylamino]propanoyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate (PubChem CID 42674558) has the molecular formula C23H32N2O6S and a molecular weight of 464.58 g/mol. Its IUPAC name is ethyl 4-[2-[3-methoxypropyl-(4-methylphenyl)sulfonylamino]propanoyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate.
| Compound Name | ethyl 4-[2-[3-methoxypropyl-(4-methylphenyl)sulfonylamino]propanoyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 42674558 |
| Molecular Formula | C23H32N2O6S |
| Molecular Weight | 464.58 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | ethyl 4-[2-[3-methoxypropyl-(4-methylphenyl)sulfonylamino]propanoyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]c(C)c(C(=O)C(C)N(CCCOC)S(=O)(=O)c2ccc(C)cc2)c1C |
| InChI | InChI=1S/C23H32N2O6S/c1-7-31-23(27)21-16(3)20(17(4)24-21)22(26)18(5)25(13-8-14-30-6)32(28,29)19-11-9-15(2)10-12-19/h9-12,18,24H,7-8,13-14H2,1-6H3 |
| InChIKey | YCYQFACPJYZRDL-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 105.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.58 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|