C22H30N2O6S — CID 42674823
methyl 4-[2-[3-methoxypropyl-(4-methylphenyl)sulfonylamino]propanoyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate (PubChem CID 42674823) has the molecular formula C22H30N2O6S and a molecular weight of 450.56 g/mol. Its IUPAC name is methyl 4-[2-[3-methoxypropyl-(4-methylphenyl)sulfonylamino]propanoyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate.
| Compound Name | methyl 4-[2-[3-methoxypropyl-(4-methylphenyl)sulfonylamino]propanoyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 42674823 |
| Molecular Formula | C22H30N2O6S |
| Molecular Weight | 450.56 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | methyl 4-[2-[3-methoxypropyl-(4-methylphenyl)sulfonylamino]propanoyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate |
| SMILES | COCCCN(C(C)C(=O)c1c(C)[nH]c(C(=O)OC)c1C)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C22H30N2O6S/c1-14-8-10-18(11-9-14)31(27,28)24(12-7-13-29-5)17(4)21(25)19-15(2)20(22(26)30-6)23-16(19)3/h8-11,17,23H,7,12-13H2,1-6H3 |
| InChIKey | VRLSJDYYLFOHLW-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 105.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.56 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|