C22H30N2O5S — CID 42822517
ethyl 4-[2-[3-ethoxypropyl(thiophene-2-carbonyl)amino]propanoyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate (PubChem CID 42822517) has the molecular formula C22H30N2O5S and a molecular weight of 434.56 g/mol. Its IUPAC name is ethyl 4-[2-[3-ethoxypropyl(thiophene-2-carbonyl)amino]propanoyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate.
| Compound Name | ethyl 4-[2-[3-ethoxypropyl(thiophene-2-carbonyl)amino]propanoyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 42822517 |
| Molecular Formula | C22H30N2O5S |
| Molecular Weight | 434.56 g/mol |
| Exact Mass | 434.19 |
| IUPAC Name | ethyl 4-[2-[3-ethoxypropyl(thiophene-2-carbonyl)amino]propanoyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate |
| SMILES | CCOCCCN(C(=O)c1cccs1)C(C)C(=O)c1c(C)[nH]c(C(=O)OCC)c1C |
| InChI | InChI=1S/C22H30N2O5S/c1-6-28-12-9-11-24(21(26)17-10-8-13-30-17)16(5)20(25)18-14(3)19(23-15(18)4)22(27)29-7-2/h8,10,13,16,23H,6-7,9,11-12H2,1-5H3 |
| InChIKey | CAGDVSQQAANWRI-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 88.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.56 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|