C21H23ClN2O4 — CID 42674703
methyl 4-[2-[(4-chlorobenzoyl)-prop-2-enylamino]propanoyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate (PubChem CID 42674703) has the molecular formula C21H23ClN2O4 and a molecular weight of 402.88 g/mol. Its IUPAC name is methyl 4-[2-[(4-chlorobenzoyl)-prop-2-enylamino]propanoyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate.
| Compound Name | methyl 4-[2-[(4-chlorobenzoyl)-prop-2-enylamino]propanoyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 42674703 |
| Molecular Formula | C21H23ClN2O4 |
| Molecular Weight | 402.88 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | methyl 4-[2-[(4-chlorobenzoyl)-prop-2-enylamino]propanoyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate |
| SMILES | C=CCN(C(=O)c1ccc(Cl)cc1)C(C)C(=O)c1c(C)[nH]c(C(=O)OC)c1C |
| InChI | InChI=1S/C21H23ClN2O4/c1-6-11-24(20(26)15-7-9-16(22)10-8-15)14(4)19(25)17-12(2)18(21(27)28-5)23-13(17)3/h6-10,14,23H,1,11H2,2-5H3 |
| InChIKey | ODVJVXQYEAHGNN-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 79.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.88 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|