C24H32N2O5 — CID 42679426
methyl 4-[2-[benzoyl(3-methoxypropyl)amino]propanoyl]-1-ethyl-3,5-dimethylpyrrole-2-carboxylate (PubChem CID 42679426) has the molecular formula C24H32N2O5 and a molecular weight of 428.53 g/mol. Its IUPAC name is methyl 4-[2-[benzoyl(3-methoxypropyl)amino]propanoyl]-1-ethyl-3,5-dimethylpyrrole-2-carboxylate.
| Compound Name | methyl 4-[2-[benzoyl(3-methoxypropyl)amino]propanoyl]-1-ethyl-3,5-dimethylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 42679426 |
| Molecular Formula | C24H32N2O5 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.23 |
| IUPAC Name | methyl 4-[2-[benzoyl(3-methoxypropyl)amino]propanoyl]-1-ethyl-3,5-dimethylpyrrole-2-carboxylate |
| SMILES | CCn1c(C)c(C(=O)C(C)N(CCCOC)C(=O)c2ccccc2)c(C)c1C(=O)OC |
| InChI | InChI=1S/C24H32N2O5/c1-7-25-17(3)20(16(2)21(25)24(29)31-6)22(27)18(4)26(14-11-15-30-5)23(28)19-12-9-8-10-13-19/h8-10,12-13,18H,7,11,14-15H2,1-6H3 |
| InChIKey | LNYTZLAXPKXILZ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 77.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|