C24H32N2O6 — CID 42677500
methyl 4-[2-[(3-methoxybenzoyl)-(3-methoxypropyl)amino]propanoyl]-1,3,5-trimethylpyrrole-2-carboxylate (PubChem CID 42677500) has the molecular formula C24H32N2O6 and a molecular weight of 444.53 g/mol. Its IUPAC name is methyl 4-[2-[(3-methoxybenzoyl)-(3-methoxypropyl)amino]propanoyl]-1,3,5-trimethylpyrrole-2-carboxylate.
| Compound Name | methyl 4-[2-[(3-methoxybenzoyl)-(3-methoxypropyl)amino]propanoyl]-1,3,5-trimethylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 42677500 |
| Molecular Formula | C24H32N2O6 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.23 |
| IUPAC Name | methyl 4-[2-[(3-methoxybenzoyl)-(3-methoxypropyl)amino]propanoyl]-1,3,5-trimethylpyrrole-2-carboxylate |
| SMILES | COCCCN(C(=O)c1cccc(OC)c1)C(C)C(=O)c1c(C)c(C(=O)OC)n(C)c1C |
| InChI | InChI=1S/C24H32N2O6/c1-15-20(16(2)25(4)21(15)24(29)32-7)22(27)17(3)26(12-9-13-30-5)23(28)18-10-8-11-19(14-18)31-6/h8,10-11,14,17H,9,12-13H2,1-7H3 |
| InChIKey | KIKTUPPRIZMVPA-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 87.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|