C25H20ClFN6O — CID 42667788
4-(2-chlorophenyl)-2-(4-fluorophenyl)-6-N-(2-phenoxyethyl)pyrazolo[3,4-d]pyrimidine-3,6-diamine (PubChem CID 42667788) has the molecular formula C25H20ClFN6O and a molecular weight of 474.93 g/mol. Its IUPAC name is 4-(2-chlorophenyl)-2-(4-fluorophenyl)-6-N-(2-phenoxyethyl)pyrazolo[3,4-d]pyrimidine-3,6-diamine.
| Compound Name | 4-(2-chlorophenyl)-2-(4-fluorophenyl)-6-N-(2-phenoxyethyl)pyrazolo[3,4-d]pyrimidine-3,6-diamine |
|---|---|
| PubChem CID | 42667788 |
| Molecular Formula | C25H20ClFN6O |
| Molecular Weight | 474.93 g/mol |
| Exact Mass | 474.14 |
| IUPAC Name | 4-(2-chlorophenyl)-2-(4-fluorophenyl)-6-N-(2-phenoxyethyl)pyrazolo[3,4-d]pyrimidine-3,6-diamine |
| SMILES | Nc1c2c(-c3ccccc3Cl)nc(NCCOc3ccccc3)nc2nn1-c1ccc(F)cc1 |
| InChI | InChI=1S/C25H20ClFN6O/c26-20-9-5-4-8-19(20)22-21-23(28)33(17-12-10-16(27)11-13-17)32-24(21)31-25(30-22)29-14-15-34-18-6-2-1-3-7-18/h1-13H,14-15,28H2,(H,29,31,32) |
| InChIKey | YHHUGMNRTVHBDX-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 90.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.93 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|