C21H20F2N6O2 — CID 42669231
4-(2,3-difluorophenyl)-6-N-(2-methoxyethyl)-2-(4-methoxyphenyl)pyrazolo[3,4-d]pyrimidine-3,6-diamine (PubChem CID 42669231) has the molecular formula C21H20F2N6O2 and a molecular weight of 426.43 g/mol. Its IUPAC name is 4-(2,3-difluorophenyl)-6-N-(2-methoxyethyl)-2-(4-methoxyphenyl)pyrazolo[3,4-d]pyrimidine-3,6-diamine.
| Compound Name | 4-(2,3-difluorophenyl)-6-N-(2-methoxyethyl)-2-(4-methoxyphenyl)pyrazolo[3,4-d]pyrimidine-3,6-diamine |
|---|---|
| PubChem CID | 42669231 |
| Molecular Formula | C21H20F2N6O2 |
| Molecular Weight | 426.43 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | 4-(2,3-difluorophenyl)-6-N-(2-methoxyethyl)-2-(4-methoxyphenyl)pyrazolo[3,4-d]pyrimidine-3,6-diamine |
| SMILES | COCCNc1nc(-c2cccc(F)c2F)c2c(N)n(-c3ccc(OC)cc3)nc2n1 |
| InChI | InChI=1S/C21H20F2N6O2/c1-30-11-10-25-21-26-18(14-4-3-5-15(22)17(14)23)16-19(24)29(28-20(16)27-21)12-6-8-13(31-2)9-7-12/h3-9H,10-11,24H2,1-2H3,(H,25,27,28) |
| InChIKey | FCEJSEJBHQCEHJ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 100.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.43 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|