C15H16F2N6O — CID 42669292
4-(2,3-difluorophenyl)-6-N-(2-methoxyethyl)-2-methylpyrazolo[3,4-d]pyrimidine-3,6-diamine (PubChem CID 42669292) has the molecular formula C15H16F2N6O and a molecular weight of 334.33 g/mol. Its IUPAC name is 4-(2,3-difluorophenyl)-6-N-(2-methoxyethyl)-2-methylpyrazolo[3,4-d]pyrimidine-3,6-diamine.
| Compound Name | 4-(2,3-difluorophenyl)-6-N-(2-methoxyethyl)-2-methylpyrazolo[3,4-d]pyrimidine-3,6-diamine |
|---|---|
| PubChem CID | 42669292 |
| Molecular Formula | C15H16F2N6O |
| Molecular Weight | 334.33 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | 4-(2,3-difluorophenyl)-6-N-(2-methoxyethyl)-2-methylpyrazolo[3,4-d]pyrimidine-3,6-diamine |
| SMILES | COCCNc1nc(-c2cccc(F)c2F)c2c(N)n(C)nc2n1 |
| InChI | InChI=1S/C15H16F2N6O/c1-23-13(18)10-12(8-4-3-5-9(16)11(8)17)20-15(19-6-7-24-2)21-14(10)22-23/h3-5H,6-7,18H2,1-2H3,(H,19,21,22) |
| InChIKey | TYFKVOKREDZMEB-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 90.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.33 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|