C26H29N3O3 — CID 42670184
N-cyclohexyl-4-(2-methoxy-4-methylphenoxy)-N-methyl-2-phenylpyrimidine-5-carboxamide (PubChem CID 42670184) has the molecular formula C26H29N3O3 and a molecular weight of 431.54 g/mol. Its IUPAC name is N-cyclohexyl-4-(2-methoxy-4-methylphenoxy)-N-methyl-2-phenylpyrimidine-5-carboxamide.
| Compound Name | N-cyclohexyl-4-(2-methoxy-4-methylphenoxy)-N-methyl-2-phenylpyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 42670184 |
| Molecular Formula | C26H29N3O3 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | N-cyclohexyl-4-(2-methoxy-4-methylphenoxy)-N-methyl-2-phenylpyrimidine-5-carboxamide |
| SMILES | COc1cc(C)ccc1Oc1nc(-c2ccccc2)ncc1C(=O)N(C)C1CCCCC1 |
| InChI | InChI=1S/C26H29N3O3/c1-18-14-15-22(23(16-18)31-3)32-25-21(26(30)29(2)20-12-8-5-9-13-20)17-27-24(28-25)19-10-6-4-7-11-19/h4,6-7,10-11,14-17,20H,5,8-9,12-13H2,1-3H3 |
| InChIKey | LBUIPVCYANVBTL-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |