C18H22N6 — CID 42671771
1-phenyl-4-piperazin-1-yl-6-propan-2-ylpyrazolo[5,4-d]pyrimidine (PubChem CID 42671771) has the molecular formula C18H22N6 and a molecular weight of 322.42 g/mol. Its IUPAC name is 1-phenyl-4-piperazin-1-yl-6-propan-2-ylpyrazolo[5,4-d]pyrimidine.
| Compound Name | 1-phenyl-4-piperazin-1-yl-6-propan-2-ylpyrazolo[5,4-d]pyrimidine |
|---|---|
| PubChem CID | 42671771 |
| Molecular Formula | C18H22N6 |
| Molecular Weight | 322.42 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | 1-phenyl-4-piperazin-1-yl-6-propan-2-ylpyrazolo[5,4-d]pyrimidine |
| SMILES | CC(C)c1nc(N2CCNCC2)c2cnn(-c3ccccc3)c2n1 |
| InChI | InChI=1S/C18H22N6/c1-13(2)16-21-17(23-10-8-19-9-11-23)15-12-20-24(18(15)22-16)14-6-4-3-5-7-14/h3-7,12-13,19H,8-11H2,1-2H3 |
| InChIKey | VDUSWBBJOIWSOY-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.42 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |