C28H40N6O — CID 93126728
1-[4-[6-[(2S)-pentan-2-yl]-1-phenylpyrazolo[5,4-d]pyrimidin-4-yl]-1,4-diazepan-1-yl]heptan-1-one (PubChem CID 93126728) has the molecular formula C28H40N6O and a molecular weight of 476.67 g/mol. Its IUPAC name is 1-[4-[6-[(2S)-pentan-2-yl]-1-phenylpyrazolo[5,4-d]pyrimidin-4-yl]-1,4-diazepan-1-yl]heptan-1-one.
| Compound Name | 1-[4-[6-[(2S)-pentan-2-yl]-1-phenylpyrazolo[5,4-d]pyrimidin-4-yl]-1,4-diazepan-1-yl]heptan-1-one |
|---|---|
| PubChem CID | 93126728 |
| Molecular Formula | C28H40N6O |
| Molecular Weight | 476.67 g/mol |
| Exact Mass | 476.33 |
| IUPAC Name | 1-[4-[6-[(2S)-pentan-2-yl]-1-phenylpyrazolo[5,4-d]pyrimidin-4-yl]-1,4-diazepan-1-yl]heptan-1-one |
| SMILES | CCCCCCC(=O)N1CCCN(c2nc([C@@H](C)CCC)nc3c2cnn3-c2ccccc2)CC1 |
| InChI | InChI=1S/C28H40N6O/c1-4-6-7-11-16-25(35)32-17-12-18-33(20-19-32)27-24-21-29-34(23-14-9-8-10-15-23)28(24)31-26(30-27)22(3)13-5-2/h8-10,14-15,21-22H,4-7,11-13,16-20H2,1-3H3/t22-/m0/s1 |
| InChIKey | UHKAZXMPFVOFSN-QFIPXVFZSA-N |
| XLogP | 5.73 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.67 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|