C27H38N6O — CID 93126692
1-[4-[6-[(2S)-pentan-2-yl]-1-phenylpyrazolo[5,4-d]pyrimidin-4-yl]-1,4-diazepan-1-yl]hexan-1-one (PubChem CID 93126692) has the molecular formula C27H38N6O and a molecular weight of 462.64 g/mol. Its IUPAC name is 1-[4-[6-[(2S)-pentan-2-yl]-1-phenylpyrazolo[5,4-d]pyrimidin-4-yl]-1,4-diazepan-1-yl]hexan-1-one.
| Compound Name | 1-[4-[6-[(2S)-pentan-2-yl]-1-phenylpyrazolo[5,4-d]pyrimidin-4-yl]-1,4-diazepan-1-yl]hexan-1-one |
|---|---|
| PubChem CID | 93126692 |
| Molecular Formula | C27H38N6O |
| Molecular Weight | 462.64 g/mol |
| Exact Mass | 462.31 |
| IUPAC Name | 1-[4-[6-[(2S)-pentan-2-yl]-1-phenylpyrazolo[5,4-d]pyrimidin-4-yl]-1,4-diazepan-1-yl]hexan-1-one |
| SMILES | CCCCCC(=O)N1CCCN(c2nc([C@@H](C)CCC)nc3c2cnn3-c2ccccc2)CC1 |
| InChI | InChI=1S/C27H38N6O/c1-4-6-8-15-24(34)31-16-11-17-32(19-18-31)26-23-20-28-33(22-13-9-7-10-14-22)27(23)30-25(29-26)21(3)12-5-2/h7,9-10,13-14,20-21H,4-6,8,11-12,15-19H2,1-3H3/t21-/m0/s1 |
| InChIKey | GBGSUUXLOKOSJO-NRFANRHFSA-N |
| XLogP | 5.34 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.64 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|