C32H40N6O2 — CID 98419133
(4-butoxyphenyl)-[4-[6-[(2S)-pentan-2-yl]-1-phenylpyrazolo[5,4-d]pyrimidin-4-yl]-1,4-diazepan-1-yl]methanone (PubChem CID 98419133) has the molecular formula C32H40N6O2 and a molecular weight of 540.71 g/mol. Its IUPAC name is (4-butoxyphenyl)-[4-[6-[(2S)-pentan-2-yl]-1-phenylpyrazolo[5,4-d]pyrimidin-4-yl]-1,4-diazepan-1-yl]methanone.
| Compound Name | (4-butoxyphenyl)-[4-[6-[(2S)-pentan-2-yl]-1-phenylpyrazolo[5,4-d]pyrimidin-4-yl]-1,4-diazepan-1-yl]methanone |
|---|---|
| PubChem CID | 98419133 |
| Molecular Formula | C32H40N6O2 |
| Molecular Weight | 540.71 g/mol |
| Exact Mass | 540.32 |
| IUPAC Name | (4-butoxyphenyl)-[4-[6-[(2S)-pentan-2-yl]-1-phenylpyrazolo[5,4-d]pyrimidin-4-yl]-1,4-diazepan-1-yl]methanone |
| SMILES | CCCCOc1ccc(C(=O)N2CCCN(c3nc([C@@H](C)CCC)nc4c3cnn4-c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C32H40N6O2/c1-4-6-22-40-27-16-14-25(15-17-27)32(39)37-19-10-18-36(20-21-37)30-28-23-33-38(26-12-8-7-9-13-26)31(28)35-29(34-30)24(3)11-5-2/h7-9,12-17,23-24H,4-6,10-11,18-22H2,1-3H3/t24-/m0/s1 |
| InChIKey | VRHPAWKEACXNQM-DEOSSOPVSA-N |
| XLogP | 6.25 |
| TPSA | 76.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.71 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|