C24H37N5O3 — CID 42677163
N-tert-butyl-4-[4-[[2-[cyclopropanecarbonyl(propyl)amino]acetyl]amino]phenyl]piperazine-1-carboxamide (PubChem CID 42677163) has the molecular formula C24H37N5O3 and a molecular weight of 443.59 g/mol. Its IUPAC name is N-tert-butyl-4-[4-[[2-[cyclopropanecarbonyl(propyl)amino]acetyl]amino]phenyl]piperazine-1-carboxamide.
| Compound Name | N-tert-butyl-4-[4-[[2-[cyclopropanecarbonyl(propyl)amino]acetyl]amino]phenyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 42677163 |
| Molecular Formula | C24H37N5O3 |
| Molecular Weight | 443.59 g/mol |
| Exact Mass | 443.29 |
| IUPAC Name | N-tert-butyl-4-[4-[[2-[cyclopropanecarbonyl(propyl)amino]acetyl]amino]phenyl]piperazine-1-carboxamide |
| SMILES | CCCN(CC(=O)Nc1ccc(N2CCN(C(=O)NC(C)(C)C)CC2)cc1)C(=O)C1CC1 |
| InChI | InChI=1S/C24H37N5O3/c1-5-12-29(22(31)18-6-7-18)17-21(30)25-19-8-10-20(11-9-19)27-13-15-28(16-14-27)23(32)26-24(2,3)4/h8-11,18H,5-7,12-17H2,1-4H3,(H,25,30)(H,26,32) |
| InChIKey | DMOSXOJCBUJQFL-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 84.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.59 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|